ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine

Catalog Number ACM1799787099
CAS 1799787-09-9
Synonyms 3-Benzylsulfanyl-N-(2-morpholin-4-ylethyl)propan-1-amine
IUPAC Name 3-benzylsulfanyl-N-(2-morpholin-4-ylethyl)propan-1-amine
Molecular Weight 294.46
Molecular Formula C16H26N2OS
InChI RGESWDWHSTVFGE-UHFFFAOYSA-N
InChI Key InChI=1S/C16H26N2OS/c1-2-5-16(6-3-1)15-20-14-4-7-17-8-9-18-10-12-19-13-11-18/h1-3,5-6,17H,4,7-15H2
Boiling Point 433.8±40.0 °C(Predicted)
Purity 98%
Isomeric SMILES C1COCCN1CCNCCCSCC2=CC=CC=C2
Q&A

What is the molecular weight of 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

The molecular weight is 294.46.

What are some synonyms for 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

Some synonyms are 4-Morpholineethanamine, N-[3-[(phenylmethyl)thio]propyl]-.

What is the chemical formula of 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

The chemical formula is C16H26N2OS.

What is the predicted boiling point of 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

The predicted boiling point is 433.8±40.0 °C.

What is the predicted pka value of 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

The predicted pka value is 10.04±0.19.

What is the predicted density of 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

The predicted density is 1.068±0.06 g/cm3.

How many carbon atoms are present in the molecular structure of 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

There are 16 carbon atoms.

What functional groups are present in the molecule of 3-(Benzylthio)-N-(2-morpholinoethyl)propan-1-amine?

The molecule contains a thioether, amine, and morpholine functional groups.

Please kindly note that our products and services are for research use only.