3,3',3''-Phosphoryltripropanoic acid

Catalog Number	ACM5962403
CAS	5962-40-3
Synonyms	Tris(2-Carboxyethyl)Phosphine Oxide; 3-[Bis(2-Carboxyethyl)Phosphoryl]Propanoic Acid
IUPAC Name	3-[bis(2-carboxyethyl)phosphoryl]propanoic acid
Molecular Weight	266.19
Molecular Formula	C9H15O7P
InChI	XJGZCDJZBUBTKW-UHFFFAOYSA-N
InChI Key	InChI=1S/C9H15O7P/c10-7(11)1-4-17(16,5-2-8(12)13)6-3-9(14)15/h1-6H2,(H,10,11)(H,12,13)(H,14,15)
Purity	95%
Isomeric SMILES	C(CP(=O)(CCC(=O)O)CCC(=O)O)C(=O)O

Q&A

What is the molecular formula of 3,3',3''-Phosphoryltripropanoic acid?

The molecular formula is C9H15O7P.

What is the exact mass of 3,3',3''-Phosphoryltripropanoic acid?

The exact mass is 266.05553981 g/mol.

How many heavy atoms are present in the chemical structure of 3,3',3''-Phosphoryltripropanoic acid?

There are 17 heavy atoms.

How many rotatable bonds are there in the structure of 3,3',3''-Phosphoryltripropanoic acid?

There are 9 rotatable bonds.

What is the Canonical SMILES of 3,3',3''-Phosphoryltripropanoic acid?

C(CP(=O)(CCC(=O)O)CCC(=O)O)C(=O)O

What is the InChIKey for 3,3',3''-Phosphoryltripropanoic acid?

XJGZCDJZBUBTKW-UHFFFAOYSA-N

How many hydrogen bond acceptors are present in the structure of 3,3',3''-Phosphoryltripropanoic acid?

There are 7 hydrogen bond acceptors.

What is the Computed Properties Topological Polar Surface Area of 3,3',3''-Phosphoryltripropanoic acid?

The Topological Polar Surface Area is 129.

What are some Depositor-Supplied Synonyms for 3,3',3''-Phosphoryltripropanoic acid?

Some synonyms include Tris(2-carboxyethyl)phosphine oxide and Z3P.

What is the IUPAC Name of 3,3',3''-Phosphoryltripropanoic acid?

The IUPAC Name is 3-[bis(2-carboxyethyl)phosphoryl]propanoic acid.