(2S,5S)-2,5-Diphenylphospholane 1-oxide

Catalog Number	ACM474093577
CAS	474093-57-7
Synonyms	(2S,5S)-2,5-Diphenylphospholan-1-ium 1-oxide
IUPAC Name	(2S,5S)-2,5-diphenylphospholan-1-ium 1-oxide
Molecular Weight	256.28
Molecular Formula	C16H17OP
InChI	QTCQCDCBVXKHMY-HOTGVXAUSA-N
InChI Key	InChI=1S/C16H16OP/c17-18-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/q+1/t15-,16-/m0/s1
Purity	98%
Isomeric SMILES	C1C[C@H]([P+](=O)[C@@H]1C2=CC=CC=C2)C3=CC=CC=C3

Q&A

What is the molecular formula of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

The molecular formula is C16H16OP+.

What is the exact mass of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

The exact mass is 255.093877127.

What is the IUPAC name of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

The IUPAC name is (2S,5S)-2,5-diphenylphospholan-1-ium 1-oxide.

How many defined atom stereocenters does (2S,5S)-2,5-Diphenylphospholane 1-oxide have?

It has 2 defined atom stereocenters.

What is the XLogP3 value of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

The XLogP3 value is 2.9.

What is the canonical SMILES of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

The canonical SMILES is C1CC([P+](=O)C1C2=CC=CC=C2)C3=CC=CC=C3.

How many hydrogen bond acceptor count does (2S,5S)-2,5-Diphenylphospholane 1-oxide have?

It has 1 hydrogen bond acceptor count.

What is the topological polar surface area of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

The topological polar surface area is 17.1.

What is the depositor-supplied synonym of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

One of the synonyms is 474093-57-7.

What is the InChIKey of (2S,5S)-2,5-Diphenylphospholane 1-oxide?

The InChIKey is QTCQCDCBVXKHMY-HOTGVXAUSA-N.