(2S,5S)-1-(((2S,5S)-2,5-Dimethylpyrrolidin-1-yl)methylene)-2,5-dimethylpyrrolidin-1-ium

Catalog Number	ACM1204324128-1
CAS	1204324-12-8
Synonyms	(2S,5S)-1-[[(2S,5S)-2,5-Dimethylpyrrolidin-1-ium-1-ylidene]methyl]-2,5-dimethylpyrrolidine
IUPAC Name	(2S,5S)-1-[[(2S,5S)-2,5-dimethylpyrrolidin-1-ium-1-ylidene]methyl]-2,5-dimethylpyrrolidine
Molecular Weight	209.35
Molecular Formula	C13H25N2
InChI	KGRQPOBWGCJTHJ-CYDGBPFRSA-N
InChI Key	InChI=1S/C13H25N2/c1-10-5-6-11(2)14(10)9-15-12(3)7-8-13(15)4/h9-13H,5-8H2,1-4H3/q+1/t10-,11-,12-,13-/m0/s1
Purity	98%
Isomeric SMILES	C[C@H]1CC[C@@H](N1C=[N+]2[C@H](CC[C@@H]2C)C)C

Q&A

What is the CAS number of the compound?

CAS: 1204324-12-8

What is the molecular weight of the compound?

MW: 209.36

What is the product name of the compound?

Product Name: (2S,5S)-1-{[(2S,5S)-2,5-Dimethylpyrrolidin-1-yl]methylene}-2,5-dimethylpyrrolidinium tetrafluoroborate, min. 97%

What are the synonyms of the compound?

Synonyms: (2S,5S)-1-{[(2S,5S)-2,5-Dimethylpyrrolidin-1-yl]methylene}-2,5-dimethylpyrrolidinium tetrafluoroborate, min. 97%; (2S,5S)-1-(((2S,5S)-2,5-Dimethylpyrrolidin-1-yl)methylene)-2,5-dimethylpyrrolidin-1-ium

What is the molecular formula of the compound?

MF: C13H25N2+

What is the melting point range of the compound?

Melting point: 112-118 °C

Is the compound at least 97% pure?

Yes, the compound is at least 97% pure.

What is the stereochemistry of the compound?

The compound has (2S,5S) stereochemistry.

What is the cation of the compound?

The cation of the compound is dimethylpyrrolidinium.

What is the anion of the compound?

The anion of the compound is tetrafluoroborate.