(2S,2'S)-2,2'-Bipyrrolidine

Catalog Number	ACM124779664-1
CAS	124779-66-4
Structure
Synonyms	Cis-2,2'-Bipyrrolidine; 2,2'-Bi[(2S)-Pyrrolidine]
IUPAC Name	(2S)-2-[(2S)-pyrrolidin-2-yl]pyrrolidine
Molecular Weight	140.32
Molecular Formula	C8H16N2
InChI	NQHVTVSAFRAXPA-YUMQZZPRSA-N
InChI Key	InChI=1S/C8H16N2/c1-3-7(9-5-1)8-4-2-6-10-8/h7-10H,1-6H2/t7-,8-/m0/s1
Melting Point	214-218 °C
Purity	97%
Appearance	White or yellow powder
Isomeric SMILES	C1C[C@H](NC1)[C@@H]2CCCN2

Q&A

What is the molecular weight of (2S,2'S)-2,2'-Bipyrrolidine?

The molecular weight is 140.23 MW.

What are some synonyms for (2S,2'S)-2,2'-Bipyrrolidine?

Some synonyms include (2S,2'S)-Octahydro-2,2'-bi[1H-pyrrole], [2S,2'S,(+)]-Octahydro-2,2'-bi[1H-pyrrole], and (S,S)-2,2'-Bipyrrolidinyl.

What is the melting point of (2S,2'S)-2,2'-Bipyrrolidine?

The melting point is 214-218 °C.

In what form is (2S,2'S)-2,2'-Bipyrrolidine found?

It is found in liquid form.

Is (2S,2'S)-Bipyrrolidine air sensitive?

Yes, it is air sensitive.

What is the boiling point of (2S,2'S)-Bipyrrolidine?

The boiling point is 97-98 °C.

What is the predicted pka value of (2S,2'S)-Bipyrrolidine?

The predicted pka value is 10.72±0.10.

What is the color of (2S,2'S)-Bipyrrolidine?

The color is colorless.

What are the Hazard Codes for (2S,2'S)-Bipyrrolidine?

The Hazard Codes are C.

What are the Safety Statements and Risk Statements associated with (2S,2'S)-Bipyrrolidine?

The Safety Statements are 26-36/37/39-45, and the Risk Statements are 22-34.