What is the molecular formula of the compound (2R,2'R,3R,3'R)-3,3'-Di-tert-butyl-4,4'-diphenyl-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole?
The molecular formula is C34H36O2P2.
What is the molecular weight of (2R,2'R,3R,3'R)-3,3'-Di-tert-butyl-4,4'-diphenyl-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole?
The molecular weight is 538.6g/mol.
How many hydrogen bond acceptor counts are there in the computed properties of the compound?
There are 2 hydrogen bond acceptor counts.
What is the Canonical SMILES representation of the compound?
CC(C)(C)P1C(OC2=CC=CC(=C21)C3=CC=CC=C3)C4OC5=CC=CC(=C5P4C(C)(C)C)C6=CC=CC=C6
How many covalently-bonded units are in the computed properties of the compound?
There is 1 covalently-bonded unit.
What is the computed XLogP3 value for (2R,2'R,3R,3'R)-3,3'-Di-tert-butyl-4,4'-diphenyl-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole?
The XLogP3 value is 7.8.
What is the IUPAC name of the compound?
The IUPAC name is (2R,3R)-3-tert-butyl-2-[(2R,3R)-3-tert-butyl-4-phenyl-2H-1,3-benzoxaphosphol-2-yl]-4-phenyl-2H-1,3-benzoxaphosphole.
What is the depositor-supplied synonyms of (2R,2'R,3R,3'R)-3,3'-Di-tert-butyl-4,4'-diphenyl-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole?
The depositor-supplied synonyms include CS-0091047 and D75386.
What is the 3D-structure of the compound (2R,2'R,3R,3'R)-3,3'-Di-tert-butyl-4,4'-diphenyl-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole?
The 3D-conformer of the compound can be found at the link provided.
How many heavy atoms are present in the computed properties of the compound?
There are 38 heavy atoms.