(2R,2'R)-2,2'-Bipyrrolidine

Catalog Number	ACM137037208-1
CAS	137037-20-8
Synonyms	2,2'-Bi[(R)-Pyrrolidine]; (2R,2'R)-2,2'-Bipyrrolidine
IUPAC Name	(2R)-2-[(2R)-pyrrolidin-2-yl]pyrrolidine
Molecular Weight	140.32
Molecular Formula	C8H16N2
InChI	NQHVTVSAFRAXPA-HTQZYQBOSA-N
InChI Key	InChI=1S/C8H16N2/c1-3-7(9-5-1)8-4-2-6-10-8/h7-10H,1-6H2/t7-,8-/m1/s1
Melting Point	212-216 °C
Purity	97%
Appearance	White or yellow powder
Isomeric SMILES	C1C[C@@H](NC1)[C@H]2CCCN2

Q&A

What is the molecular weight of (2R,2'R)-2,2'-Bipyrrolidine?

The molecular weight of (2R,2'R)-2,2'-Bipyrrolidine is 140.23.

What is the product name of (2R,2'R)-2,2'-Bipyrrolidine?

The product name is (R,R)-2,2'-Bipyrrolidinyl.

What is the melting point of (2R,2'R)-2,2'-Bipyrrolidine?

The melting point is 212-216 °C.

What is the alpha value of (2R,2'R)-2,2'-Bipyrrolidine in methanol?

The alpha value is -14.91 (c 1.03, methanol).

What is the storage temperature recommended for (2R,2'R)-2,2'-Bipyrrolidine?

The recommended storage temperature is 2-8°C.

Is (2R,2'R)-2,2'-Bipyrrolidine air sensitive?

Yes, it is air sensitive.

What is the predicted boiling point of (2R,2'R)-2,2'-Bipyrrolidine?

The predicted boiling point is 150 °C (Press: 15 Torr).

What is the predicted pka value of (2R,2'R)-2,2'-Bipyrrolidine?

The predicted pka value is 10.72±0.10.

In what form is (2R,2'R)-2,2'-Bipyrrolidine?

It is in liquid form.

What safety statements are associated with (2R,2'R)-2,2'-Bipyrrolidine?

The safety statements are 26-36/37/39-45.