2-(Pyren-1-yl)-1,10-phenanthroline

Catalog Number	ACM197852929
CAS	197852-92-9
Synonyms	2-Pyren-1-Yl-1,10-Phenanthroline
IUPAC Name	2-pyren-1-yl-1,10-phenanthroline
Molecular Weight	380.44
Molecular Formula	C28H16N2
InChI	ZYXMUDSQPAMEGC-UHFFFAOYSA-N
InChI Key	InChI=1S/C28H16N2/c1-3-17-6-7-19-10-13-22(23-14-11-18(4-1)25(17)26(19)23)24-15-12-21-9-8-20-5-2-16-29-27(20)28(21)30-24/h1-16H
Purity	98%
Isomeric SMILES	C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C5=NC6=C(C=CC7=C6N=CC=C7)C=C5

Q&A

What is the CAS number for 2-(Pyren-1-yl)-1,10-phenanthroline?

CAS: 197852-92-9

What is the molecular weight of 2-(Pyren-1-yl)-1,10-phenanthroline?

MW: 380.44

What is another name for 2-(Pyren-1-yl)-1,10-phenanthroline?

1,10-Phenanthroline, 2-(1-pyrenyl)-

What is the chemical formula of 2-(Pyren-1-yl)-1,10-phenanthroline?

MF: C28H16N2

What is the predicted boiling point of 2-(Pyren-1-yl)-1,10-phenanthroline?

Boiling point: 628.6±45.0 °C

What is the predicted pka value of 2-(Pyren-1-yl)-1,10-phenanthroline?

pka: 4.56±0.10

What is the predicted density of 2-(Pyren-1-yl)-1,10-phenanthroline?

Density: 1.349±0.06 g/cm3

What are some synonyms for 2-(Pyren-1-yl)-1,10-phenanthroline?

1,10-Phenanthroline, 2-(1-pyrenyl)-; 2-(1'-pyrenyl)-1,10-phenanthroline

How many carbon atoms are in the chemical formula of 2-(Pyren-1-yl)-1,10-phenanthroline?

28 carbon atoms

What is the chemical structure of 2-(Pyren-1-yl)-1,10-phenanthroline?

The chemical structure consists of a phenanthroline ring with a pyrenyl group attached at position 2.