2-Phenylquinoline acid

Catalog Number	ACM132605-1
CAS	132-60-5
Structure
Synonyms	2-Phenyl-4-quinolinecarboxylic acid
IUPAC Name	2-phenylquinoline-4-carboxylic acid
Molecular Weight	249.26
Molecular Formula	C16H11NO2
InChI	YTRMTPPVNRALON-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H11NO2/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H,(H,18,19)
Melting Point	214-215 °C-lit.
Purity	99%
Appearance	Light yellow solid
Isomeric SMILES	C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O

Q&A

What is the molecular weight of 2-Phenylquinoline acid?

The molecular weight is 249.26.

What are the product categories that 2-Phenylquinoline acid belongs to?

The product categories include ATOPHAN, API intermediates, Quinolinecarboxylic Acids, etc., and Quinolines.

What are some synonyms for 2-Phenylquinoline acid?

Some synonyms include LABOTEST-BB LT00453769, RHEUMIN, RHEMATAN, and CINCHOPHEN.

What is the melting point of 2-Phenylquinoline acid?

The melting point is 214-215 °C (lit.).

What is the color of 2-Phenylquinoline acid?

The color is white.

What are the safety statements associated with 2-Phenylquinoline acid?

The safety statements are 36/37/39-26.

What is the hazard class of 2-Phenylquinoline acid?

The hazard class is 6.1(b).

In what form does 2-Phenylquinoline acid exist?

It exists in the form of a solid.

What are some brand names for 2-Phenylquinoline acid?

Some brand names include Aglophenyl, Alcophenyl, Atophan, and Tervalon.

What are the uses of 2-Phenylquinoline acid?

It can show antipyretic, analgesic, anti-oxidative, and anti-inflammatory properties.