2-Phenylbenzoxazole

Catalog Number	ACM833501-1
CAS	833-50-1
Structure
Synonyms	2-Phenylbenzo[d]oxazole; Benzoxazole, 2-phenyl-
IUPAC Name	2-phenyl-1,3-benzoxazole
Molecular Weight	195.22
Molecular Formula	C13H9NO
Canonical SMILES	C1=CC=C(C=C1)C2=NC3=CC=CC=C3O2
InChI	FIISKTXZUZBTRC-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H9NO/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9H
Melting Point	102-104 °C-lit.
Appearance	Solid
Complexity	213
Covalently-Bonded Unit Count	1
Exact Mass	195.068413911
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	195.068413911
Rotatable Bond Count	1
Topological Polar Surface Area	26 Ų

Q&A

What is the chemical formula for 2-Phenylbenzoxazole?

The chemical formula for 2-Phenylbenzoxazole is C13H9NO.

What is the molecular weight of 2-Phenylbenzoxazole?

The molecular weight of 2-Phenylbenzoxazole is 195.22.

Is 2-Phenylbenzoxazole soluble in water?

No, 2-Phenylbenzoxazole is insoluble in water.

What is the melting point of 2-Phenylbenzoxazole?

The melting point of 2-Phenylbenzoxazole is 102-104 °C.

What is the hazard code associated with 2-Phenylbenzoxazole?

The hazard code associated with 2-Phenylbenzoxazole is Xi.

What is the color of 2-Phenylbenzoxazole?

The color of 2-Phenylbenzoxazole can range from white to light yellow to dark green.

What is the boiling point of 2-Phenylbenzoxazole?

The boiling point of 2-Phenylbenzoxazole is approximately 331.88°C.

What is the chemical property of 2-Phenylbenzoxazole?

The chemical property of 2-Phenylbenzoxazole is described as light yellow-beige crystalline powder.

What is the EPA Substance Registry System number for 2-Phenylbenzoxazole?

The EPA Substance Registry System number for 2-Phenylbenzoxazole is 833-50-1.

What are some of the product categories that 2-Phenylbenzoxazole falls under?

Some product categories that 2-Phenylbenzoxazole falls under include Building Blocks, Chemical Synthesis, and Heterocyclic Building Blocks.