2-Phenylbenzothiazole

Catalog Number	ACM883932-1
CAS	883-93-2
Structure
Synonyms	2-Phenyl-1,3-benzothiazole
IUPAC Name	2-phenyl-1,3-benzothiazole
Molecular Weight	211.28
Molecular Formula	C13H9NS
Canonical SMILES	C1=CC=C(C=C1)C2=NC3=CC=CC=C3S2
InChI	XBHOUXSGHYZCNH-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H9NS/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9H
Boiling Point	371 °C
Melting Point	111-113 °C -lit.
Appearance	Grey needle-like crystals
Storage	Store below +30°C.
Complexity	213
Covalently-Bonded Unit Count	1
EC Number	212-935-3
Exact Mass	211.04557046
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	211.04557046
Rotatable Bond Count	1
Topological Polar Surface Area	41.1 Ų

Q&A

What is the CAS number of 2-Phenylbenzothiazole?

The CAS number of 2-Phenylbenzothiazole is 883-93-2.

What is the molecular weight of 2-Phenylbenzothiazole?

The molecular weight of 2-Phenylbenzothiazole is 211.28.

What are the product categories that 2-Phenylbenzothiazole belongs to?

2-Phenylbenzothiazole belongs to the product categories of Thiazoles, BENZOTHIAZOLE, API intermediates, Building Blocks, and Heterocyclic Building Blocks.

What is another name for 2-Phenylbenzothiazole?

Another name for 2-Phenylbenzothiazole is 2-Phenyl-1,3-benzothiazole.

What is the melting point of 2-Phenylbenzothiazole?

The melting point of 2-Phenylbenzothiazole is 111-113 °C.

Is 2-Phenylbenzothiazole soluble in water?

No, 2-Phenylbenzothiazole is insoluble in water.

What is the boiling point of 2-Phenylbenzothiazole?

The boiling point of 2-Phenylbenzothiazole is 371 °C.

What is the color of 2-Phenylbenzothiazole?

The color of 2-Phenylbenzothiazole is white to off-white.

What are the safety statements associated with 2-Phenylbenzothiazole?

The safety statements associated with 2-Phenylbenzothiazole are 24/25-26.

What are some of the uses of 2-Phenylbenzothiazole?

2-Phenylbenzothiazole is an organic compound that was detected in water and sediment from sedimentation ponds as a contaminant.