2-Methylpropane-1,3-diamine

Catalog Number	ACM2400784-1
CAS	2400-78-4
Structure
Synonyms	1,3-Diamino-2-methylpropane
IUPAC Name	2-methylpropane-1,3-diamine
Molecular Weight	88.15
Molecular Formula	C4H12N2
InChI	BDXGMDGYOIWKIF-UHFFFAOYSA-N
InChI Key	InChI=1S/C4H12N2/c1-4(2-5)3-6/h4H,2-3,5-6H2,1H3
Purity	98%
Appearance	Liquid
Isomeric SMILES	CC(CN)CN

Q&A

What is the molecular weight of 2-Methylpropane-1,3-diamine?

The molecular weight of 2-Methylpropane-1,3-diamine is 88.15.

What is another name for 2-Methylpropane-1,3-diamine?

Another name for 2-Methylpropane-1,3-diamine is 2-Methyl-1,3-propanediamine.

What is the boiling point of 2-Methylpropane-1,3-diamine?

The boiling point of 2-Methylpropane-1,3-diamine is 137℃.

What is the refractive index range of 2-Methylpropane-1,3-diamine?

The refractive index range of 2-Methylpropane-1,3-diamine is 1.4540 to 1.4580.

What is the predicted pka value of 2-Methylpropane-1,3-diamine?

The predicted pka value of 2-Methylpropane-1,3-diamine is 10.49±0.10.

What is the color of 2-Methylpropane-1,3-diamine?

The color of 2-Methylpropane-1,3-diamine is colorless to almost colorless.

What is the density of 2-Methylpropane-1,3-diamine?

The density of 2-Methylpropane-1,3-diamine is 0.88.

What is the flash point of 2-Methylpropane-1,3-diamine?

The flash point of 2-Methylpropane-1,3-diamine is 35℃.

According to RIDADR classification, what is the hazard class of 2-Methylpropane-1,3-diamine?

According to RIDADR classification, the hazard class of 2-Methylpropane-1,3-diamine is 8/3.

What is the HS Code for 2-Methylpropane-1,3-diamine?

The HS Code for 2-Methylpropane-1,3-diamine is 2921.29.0055.