2-Methyl-6-phenylpyridine

Catalog Number	ACM46181300-1
CAS	46181-30-0
Structure
Synonyms	6-Phenyl-2-Picoline
IUPAC Name	2-methyl-6-phenylpyridine
Molecular Weight	169.22
Molecular Formula	C12H11N
InChI	GREMYQDDZRJQEG-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H11N/c1-10-6-5-9-12(13-10)11-7-3-2-4-8-11/h2-9H,1H3
Purity	98%+
Appearance	Liqiud
Isomeric SMILES	CC1=NC(=CC=C1)C2=CC=CC=C2

Q&A

What is the chemical formula for 2-Methyl-6-phenylpyridine?

The chemical formula for 2-Methyl-6-phenylpyridine is C12H11N.

What is the molecular weight of 2-Methyl-6-phenylpyridine?

The molecular weight of 2-Methyl-6-phenylpyridine is 169.22 g/mol.

What is the boiling point of 2-Methyl-6-phenylpyridine?

The boiling point of 2-Methyl-6-phenylpyridine is 155 °C at 20 mmHg.

What is the refractive index range of 2-Methyl-6-phenylpyridine?

The refractive index range of 2-Methyl-6-phenylpyridine is 1.6080 to 1.6120.

What is the form of 2-Methyl-6-phenylpyridine?

The form of 2-Methyl-6-phenylpyridine is a clear liquid.

What is the color of 2-Methyl-6-phenylpyridine?

The color of 2-Methyl-6-phenylpyridine is colorless to almost colorless.

What is the density of 2-Methyl-6-phenylpyridine at 0 °C?

The density of 2-Methyl-6-phenylpyridine at 0 °C is 1.0731 g/cm3.

What is the storage temperature recommended for 2-Methyl-6-phenylpyridine?

The recommended storage temperature for 2-Methyl-6-phenylpyridine is in an inert atmosphere at room temperature.

What is the pKa value predicted for 2-Methyl-6-phenylpyridine?

The predicted pKa value for 2-Methyl-6-phenylpyridine is 5.16 ± 0.10.

What is the HS Code for 2-Methyl-6-phenylpyridine?

The HS Code for 2-Methyl-6-phenylpyridine is 29333990.