2-Methyl-1,10-phenanthroline

Catalog Number	ACM3002775-1
CAS	3002-77-5
Structure
Synonyms	Methyl-1,10-phenanthroline; 1,10-Phenanthroline, 2-methyl-
IUPAC Name	2-methyl-1,10-phenanthroline
Molecular Weight	194.23
Molecular Formula	C13H10N2
Canonical SMILES	CC1=NC2=C(C=C1)C=CC3=C2N=CC=C3
InChI	LQZDYPHFVGRHKD-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H10N2/c1-9-4-5-11-7-6-10-3-2-8-14-12(10)13(11)15-9/h2-8H,1H3
Boiling Point	364.872 °C at 760 mmHg
Melting Point	50-53 °C
Purity	98%
Complexity	229
Covalently-Bonded Unit Count	1
Exact Mass	194.084398327
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	194.084398327
Rotatable Bond Count	0
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of 2-methyl-1,10-phenanthroline?

The molecular weight of 2-methyl-1,10-phenanthroline is 194.23.

In which product categories is 2-methyl-1,10-phenanthroline classified?

2-methyl-1,10-phenanthroline is classified in MOFS and COFS product categories.

What are some synonyms for 2-methyl-1,10-phenanthroline?

Some synonyms for 2-methyl-1,10-phenanthroline include 1,10-Phenanthroline,2-Methyl- and 2-Methyl-1,10-phenanthroline.

What is the chemical formula of 2-methyl-1,10-phenanthroline?

The chemical formula of 2-methyl-1,10-phenanthroline is C13H10N2.

What is the melting point of 2-methyl-1,10-phenanthroline?

The melting point of 2-methyl-1,10-phenanthroline is 50-53 °C.

What is the form of 2-methyl-1,10-phenanthroline?

2-methyl-1,10-phenanthroline is in the form of powder to crystal.

What color does 2-methyl-1,10-phenanthroline appear in?

2-methyl-1,10-phenanthroline appears in a range of colors from light orange to yellow to green.

What is the boiling point of 2-methyl-1,10-phenanthroline?

The boiling point of 2-methyl-1,10-phenanthroline is 175°C at 0.2mmHg.

How should 2-methyl-1,10-phenanthroline be stored?

2-methyl-1,10-phenanthroline should be sealed in dry, room temperature storage.

What is the predicted pKa value of 2-methyl-1,10-phenanthroline?

The predicted pKa value of 2-methyl-1,10-phenanthroline is 5.63±0.40.