What is the CAS number of (2-Methoxyethyl)(triphenyl)phosphonium?
The CAS number of (2-Methoxyethyl)(triphenyl)phosphonium is 55894-16-1.
What is the exact mass of (2-Methoxyethyl)(triphenyl)phosphonium?
The exact mass of (2-Methoxyethyl)(triphenyl)phosphonium is 400.05916.
How many heavy atoms does (2-Methoxyethyl)(triphenyl)phosphonium contain?
(2-Methoxyethyl)(triphenyl)phosphonium contains 24 heavy atoms.
How many rotatable bond counts does (2-Methoxyethyl)(triphenyl)phosphonium have?
(2-Methoxyethyl)(triphenyl)phosphonium has 6 rotatable bond counts.
What is the molecular formula of (2-Methoxyethyl)(triphenyl)phosphonium?
The molecular formula of (2-Methoxyethyl)(triphenyl)phosphonium is C21H22BrOP.
What is the formal charge of (2-Methoxyethyl)(triphenyl)phosphonium?
The formal charge of (2-Methoxyethyl)(triphenyl)phosphonium is 0.
What is the IUPAC name of (2-Methoxyethyl)(triphenyl)phosphonium?
The IUPAC name of (2-Methoxyethyl)(triphenyl)phosphonium is 2-methoxyethyl(triphenyl)phosphanium;bromide.
How many hydrogen bond acceptor counts does (2-Methoxyethyl)(triphenyl)phosphonium have?
(2-Methoxyethyl)(triphenyl)phosphonium has 2 hydrogen bond acceptor counts.
What is the canonical SMILES of (2-Methoxyethyl)(triphenyl)phosphonium?
The canonical SMILES of (2-Methoxyethyl)(triphenyl)phosphonium is COCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-].