What is the InChIKey of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid?
The InChIKey of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid is ZQPHYRWKVXUKHI-UHFFFAOYSA-N.
What is the Canonical SMILES for 2-((Diphenylphosphoryl)(methyl)amino)acetic acid?
The Canonical SMILES for 2-((Diphenylphosphoryl)(methyl)amino)acetic acid is CN(CC(=O)O)P(=O)(C1=CC=CC=C1)C2=CC=CC=C2.
What is the CAS number of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid?
The CAS number of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid is 62316-79-4.
What is the exact mass of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid?
The exact mass of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid is 289.08678037.
What is the IUPAC name of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid?
The IUPAC name of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid is 2-[diphenylphosphoryl(methyl)amino]acetic acid.
How many hydrogen bond acceptor counts does 2-((Diphenylphosphoryl)(methyl)amino)acetic acid have?
2-((Diphenylphosphoryl)(methyl)amino)acetic acid has 4 hydrogen bond acceptor counts.
What is the molecular formula of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid?
The molecular formula of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid is C15H16NO3P.
What is the molecular weight of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid?
The molecular weight of 2-((Diphenylphosphoryl)(methyl)amino)acetic acid is 289.27g/mol.
How many rotatable bond counts does 2-((Diphenylphosphoryl)(methyl)amino)acetic acid have?
2-((Diphenylphosphoryl)(methyl)amino)acetic acid has 5 rotatable bond counts.