ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2-Diphenylphosphinobenzaldehyde

Catalog Number ACM50777769-1
CAS 50777-76-9
Structure {[CurrentData.Name]}
Synonyms (2-Formylphenyl)Diphenylphosphine; O-(Diphenylphosphino)Benzaldehyde
IUPAC Name 2-diphenylphosphanylbenzaldehyde
Molecular Weight 290.30
Molecular Formula C19H15OP
InChI DRCPJRZHAJMWOU-UHFFFAOYSA-N
InChI Key InChI=1S/C19H15OP/c20-15-16-9-7-8-14-19(16)21(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-15H
Boiling Point 417.4±28.0 °C(Predicted)
Melting Point 112-115 °C(lit.)
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C=O
Q&A

What is the CAS number of 2-Diphenylphosphinobenzaldehyde?

The CAS number of 2-Diphenylphosphinobenzaldehyde is 50777-76-9.

What is the Canonical SMILES of 2-Diphenylphosphinobenzaldehyde?

The Canonical SMILES of 2-Diphenylphosphinobenzaldehyde is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C=O.

What is the molecular weight of 2-Diphenylphosphinobenzaldehyde?

The molecular weight of 2-Diphenylphosphinobenzaldehyde is 290.3g/mol.

How many heavy atoms are present in the molecule of 2-Diphenylphosphinobenzaldehyde?

There are 21 heavy atoms present in the molecule of 2-Diphenylphosphinobenzaldehyde.

What is the IUPAC Name of 2-Diphenylphosphinobenzaldehyde?

The IUPAC Name of 2-Diphenylphosphinobenzaldehyde is 2-diphenylphosphanylbenzaldehyde.

What is the InChIKey of 2-Diphenylphosphinobenzaldehyde?

The InChIKey of 2-Diphenylphosphinobenzaldehyde is DRCPJRZHAJMWOU-UHFFFAOYSA-N.

How many rotatable bond counts are there in the molecule of 2-Diphenylphosphinobenzaldehyde?

There are 4 rotatable bond counts in the molecule of 2-Diphenylphosphinobenzaldehyde.

What is the computed topological polar surface area of 2-Diphenylphosphinobenzaldehyde?

The computed topological polar surface area of 2-Diphenylphosphinobenzaldehyde is 17.1.

What are some depositors supplied synonyms for 2-Diphenylphosphinobenzaldehyde?

Some depositors supplied synonyms for 2-Diphenylphosphinobenzaldehyde include o-Diphenylphosphinobenzaldehyde, 2-(diphenylphosphanyl)benzaldehyde, and (2-Formylphenyl)diphenylphosphine.

What is the molecular formula of 2-Diphenylphosphinobenzaldehyde?

The molecular formula of 2-Diphenylphosphinobenzaldehyde is C19H15OP.

Please kindly note that our products and services are for research use only.