What is the CAS number for (2-(Diphenylphosphino)phenyl)methanamine?
The CAS number is 177263-77-3.
What is the Canonical SMILES for (2-(Diphenylphosphino)phenyl)methanamine?
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3CN
How many heavy atoms are present in the molecular structure of (2-(Diphenylphosphino)phenyl)methanamine?
There are 21 heavy atoms.
What is the molecular weight of (2-(Diphenylphosphino)phenyl)methanamine?
The molecular weight is 291.3 g/mol.
What is the IUPAC name for (2-(Diphenylphosphino)phenyl)methanamine?
The IUPAC name is (2-diphenylphosphanylphenyl)methanamine.
What is the InChIKey for (2-(Diphenylphosphino)phenyl)methanamine?
The InChIKey is VZWQMZQAMZETMA-UHFFFAOYSA-N.
How many hydrogen bond acceptors are present in the structure of (2-(Diphenylphosphino)phenyl)methanamine?
There is 1 hydrogen bond acceptor.
What is the XLogP3 value for (2-(Diphenylphosphino)phenyl)methanamine?
The XLogP3 value is 3.5.
What is the topological polar surface area of (2-(Diphenylphosphino)phenyl)methanamine?
The topological polar surface area is 26.
What is the Depositor-Supplied Synonym for (2-(Diphenylphosphino)phenyl)methanamine that includes the word "benzene"?
Benzenemethanamine, 2-(diphenylphosphino)-