What is the CAS number for 2-(Diphenylphosphino)-N,N-diethylethanamine?
The CAS number for 2-(Diphenylphosphino)-N,N-diethylethanamine is 2359-97-9.
What is the Canonical SMILES representation of 2-(Diphenylphosphino)-N,N-diethylethanamine?
The Canonical SMILES representation is CCN(CC)CCP(C1=CC=CC=C1)C2=CC=CC=C2.
How many heavy atoms are present in the molecular structure of 2-(Diphenylphosphino)-N,N-diethylethanamine?
There are 20 heavy atoms present in the molecular structure.
What is the molecular weight of 2-(Diphenylphosphino)-N,N-diethylethanamine?
The molecular weight is 285.4g/mol.
How many rotatable bonds are present in the molecule?
There are 7 rotatable bonds present in the molecule.
What is the topological polar surface area of 2-(Diphenylphosphino)-N,N-diethylethanamine?
The topological polar surface area is 3.2.
What is the InChIKey for 2-(Diphenylphosphino)-N,N-diethylethanamine?
The InChIKey is TZOBMGQRKSWJAI-UHFFFAOYSA-N.
Under what name is 2-(Diphenylphosphino)-N,N-diethylethanamine also known as?
It is also known as Ethanamine, 2-(diphenylphosphino)-N,N-diethyl-.
What is the molecular formula of 2-(Diphenylphosphino)-N,N-diethylethanamine?
The molecular formula is C18H24NP.
What is the exact mass of 2-(Diphenylphosphino)-N,N-diethylethanamine?
The exact mass is 285.164636767.