What is the CAS number of 2-(Diphenylphosphino)-N-methylaniline?
The CAS number is 140669-65-4.
What is the molecular weight of 2-(Diphenylphosphino)-N-methylaniline?
The molecular weight is 291.3g/mol.
What is the IUPAC name of 2-(Diphenylphosphino)-N-methylaniline?
The IUPAC name is 2-diphenylphosphanyl-N-methylaniline.
What is the molecular formula of 2-(Diphenylphosphino)-N-methylaniline?
The molecular formula is C19H18NP.
How many heavy atoms are present in the structure of 2-(Diphenylphosphino)-N-methylaniline?
There are 21 heavy atoms.
What is the exact mass of 2-(Diphenylphosphino)-N-methylaniline?
The exact mass is 291.117686576.
How many covalently-bonded units are present in 2-(Diphenylphosphino)-N-methylaniline?
There is 1 covalently-bonded unit.
How many rotatable bond counts are there in 2-(Diphenylphosphino)-N-methylaniline?
There are 4 rotatable bond counts.
What is the Canonical SMILES representation of 2-(Diphenylphosphino)-N-methylaniline?
CNC1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3
What are some of the Depositor-Supplied Synonyms for 2-(Diphenylphosphino)-N-methylaniline?
Some Depositor-Supplied Synonyms are Benzenamine, 2-(diphenylphosphino)-N-methyl-, SCHEMBL18729658, DTXSID90476477.