What is the IUPAC name of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
The IUPAC name is 2-(2-dicyclohexylphosphanylphenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine.
What is the CAS number of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
The CAS number is 1160556-64-8.
What is the molecular formula of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
The molecular formula is C28H41N2P.
What is the molecular weight of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
The molecular weight is 436.6g/mol.
What is the exact mass of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
The exact mass is 436.30073631.
What is the Canonical SMILES of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
CN(C)C1=C(C(=CC=C1)N(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4.
How many heavy atoms are present in the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
There are 31 heavy atoms.
What is the XLogP3 value of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
The XLogP3 value is 7.
How many rotatable bonds are present in the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
There are 6 rotatable bonds.
What is the InChIKey of the chemical structure with the compound "2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl"?
The InChIKey is DRNAQRXLOSUHBQ-UHFFFAOYSA-N.