2'-Dicyclohexylphosphino-2,4,6-trimethoxybiphenyl

Catalog Number	ACM1000171050-2
CAS	1000171-05-0
Synonyms	Dicyclohexyl(2',4',6'-trimethoxy[1,1'-biphenyl]-2-yl)-phosphine
IUPAC Name	dicyclohexyl-[2-(2,4,6-trimethoxyphenyl)phenyl]phosphane
Molecular Weight	440.55
Molecular Formula	C27H37O3P
InChI	NTHFAYYJLKWDAE-UHFFFAOYSA-N
InChI Key	InChI=1S/C27H37O3P/c1-28-20-18-24(29-2)27(25(19-20)30-3)23-16-10-11-17-26(23)31(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h10-11,16-19,21-22H,4-9,12-15H2,1-3H3
Melting Point	148-158 °C
Purity	97%
Appearance	Solid
Isomeric SMILES	COC1=CC(=C(C(=C1)OC)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4)OC

Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is dicyclohexyl-[2-(2,4,6-trimethoxyphenyl)phenyl]phosphane.

What is the European Community (EC) Number of the compound?

The European Community (EC) Number of the compound is 631-191-4.

How many heavy atoms are present in the compound?

There are 31 heavy atoms present in the compound.

What is the exact mass of the compound?

The exact mass of the compound is 440.24803204.

What is the molecular weight of the compound?

The molecular weight of the compound is 440.6g/mol.

How many rotatable bonds are there in the compound?

There are 7 rotatable bonds in the compound.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES representation of the compound is COC1=CC(=C(C(=C1)OC)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4)OC.

What is the InChIKey of the compound?

The InChIKey of the compound is NTHFAYYJLKWDAE-UHFFFAOYSA-N.

What are some other synonyms of the compound?

Some other synonyms of the compound include Dicyclohexyl(2',4',6'-trimethoxy[1,1'-biphenyl]-2-yl)phosphane, SCHEMBL16333933, and CS-0086726.

What is the CAS number of the compound?

The CAS number of the compound is 1000171-05-0.