2-(Di-i-propylphosphino)ethylamine

Catalog Number	ACM1053657149-2
CAS	1053657-14-9
Synonyms	(2-Aminoethyl)Bis(Propan-2-YL)Phosphane; 2-[Bis(1-methylethyl)phosphino]ethanamine
IUPAC Name	2-di(propan-2-yl)phosphanylethanamine
Molecular Weight	161.22
Molecular Formula	C8H20NP
InChI	QUVUVMRUSAKOPB-UHFFFAOYSA-N
InChI Key	InChI=1S/C8H20NP/c1-7(2)10(6-5-9)8(3)4/h7-8H,5-6,9H2,1-4H3
Boiling Point	208.8±23.0 °C(Predicted)
Flash Point	-16 °C
Purity	98%
Density	0.872 g/mL at 25 °C
Appearance	Liquid
Isomeric SMILES	CC(C)P(CCN)C(C)C
pKa	10.33±0.10(Predicted)

Q&A

What is the CAS number of 2-(Di-i-propylphosphino)ethylamine?

The CAS number of 2-(Di-i-propylphosphino)ethylamine is 1053657-14-9.

What is the Canonical SMILES of 2-(Di-i-propylphosphino)ethylamine?

The Canonical SMILES of 2-(Di-i-propylphosphino)ethylamine is CC(C)P(CCN)C(C)C.

How many computed properties does 2-(Di-i-propylphosphino)ethylamine have?

2-(Di-i-propylphosphino)ethylamine has 14 computed properties.

What is the molecular formula of 2-(Di-i-propylphosphino)ethylamine?

The molecular formula of 2-(Di-i-propylphosphino)ethylamine is C8H20NP.

What is the exact mass of 2-(Di-i-propylphosphino)ethylamine?

The exact mass of 2-(Di-i-propylphosphino)ethylamine is 161.133336640.

What is the IUPAC name of 2-(Di-i-propylphosphino)ethylamine?

The IUPAC name of 2-(Di-i-propylphosphino)ethylamine is 2-di(propan-2-yl)phosphanylethanamine.

How many hydrogen bond acceptor count does 2-(Di-i-propylphosphino)ethylamine have?

2-(Di-i-propylphosphino)ethylamine has 1 hydrogen bond acceptor count.

What is the InChIKey of 2-(Di-i-propylphosphino)ethylamine?

The InChIKey of 2-(Di-i-propylphosphino)ethylamine is QUVUVMRUSAKOPB-UHFFFAOYSA-N.

What is the molecular weight of 2-(Di-i-propylphosphino)ethylamine?

The molecular weight of 2-(Di-i-propylphosphino)ethylamine is 161.22g/mol.

What is the Depositor-Supplied Synonyms of 2-(Di-i-propylphosphino)ethylamine?

The Depositor-Supplied Synonyms of 2-(Di-i-propylphosphino)ethylamine are 2-[Bis(1-methylethyl)phosphino]ethanamine, 2-(DI-I-PROPYLPHOSPHINO)ETHYLAMINE, and others.