ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

(2-Chlorophenyl)diphenylphosphine

Catalog Number ACM35035622
CAS 35035-62-2
Structure (2-Chlorophenyl)diphenylphosphine
Synonyms Diphenyl(2-Chlorophenyl)Phosphine
IUPAC Name (2-chlorophenyl)-diphenylphosphane
Molecular Weight 296.73
Molecular Formula C18H14ClP
InChI HGHHUFKKOXRZTH-UHFFFAOYSA-N
InChI Key InChI=1S/C18H14ClP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H
Purity 97%
Isomeric SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3Cl
Q&A

What is the CAS number for (2-Chlorophenyl)diphenylphosphine?

The CAS number is 35035-62-2.

What is the computed property for the Heavy Atom Count of (2-Chlorophenyl)diphenylphosphine?

The computed property for the Heavy Atom Count is 20.

What is the molecular weight of (2-Chlorophenyl)diphenylphosphine?

The molecular weight is 296.7g/mol.

What is the Exact Mass of (2-Chlorophenyl)diphenylphosphine?

The Exact Mass is 296.0521651.

What is the Canonical SMILES representation of (2-Chlorophenyl)diphenylphosphine?

The Canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3Cl.

What is the InChIKey for (2-Chlorophenyl)diphenylphosphine?

The InChIKey is HGHHUFKKOXRZTH-UHFFFAOYSA-N.

How many Covalently-Bonded Units are there in (2-Chlorophenyl)diphenylphosphine?

There is 1 Covalently-Bonded Unit.

What is the IUPAC Name of (2-Chlorophenyl)diphenylphosphine?

The IUPAC Name is (2-Chlorophenyl)-diphenylphosphane.

What is the topological polar surface area for (2-Chlorophenyl)diphenylphosphine?

The topological polar surface area is 0.

What are some of the depositor-supplied synonyms for (2-Chlorophenyl)diphenylphosphine?

Some synonyms include (2-chlorophenyl)(diphenyl)phosphane, NSC193772, and F72577.

Please kindly note that our products and services are for research use only.