What is the CAS number for (2-Chlorophenyl)diphenylphosphine?
The CAS number is 35035-62-2.
What is the computed property for the Heavy Atom Count of (2-Chlorophenyl)diphenylphosphine?
The computed property for the Heavy Atom Count is 20.
What is the molecular weight of (2-Chlorophenyl)diphenylphosphine?
The molecular weight is 296.7g/mol.
What is the Exact Mass of (2-Chlorophenyl)diphenylphosphine?
The Exact Mass is 296.0521651.
What is the Canonical SMILES representation of (2-Chlorophenyl)diphenylphosphine?
The Canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3Cl.
What is the InChIKey for (2-Chlorophenyl)diphenylphosphine?
The InChIKey is HGHHUFKKOXRZTH-UHFFFAOYSA-N.
How many Covalently-Bonded Units are there in (2-Chlorophenyl)diphenylphosphine?
There is 1 Covalently-Bonded Unit.
What is the IUPAC Name of (2-Chlorophenyl)diphenylphosphine?
The IUPAC Name is (2-Chlorophenyl)-diphenylphosphane.
What is the topological polar surface area for (2-Chlorophenyl)diphenylphosphine?
The topological polar surface area is 0.
What are some of the depositor-supplied synonyms for (2-Chlorophenyl)diphenylphosphine?
Some synonyms include (2-chlorophenyl)(diphenyl)phosphane, NSC193772, and F72577.