2-Bromophenyldiphenylphosphine

Catalog Number	ACM62336247-1
CAS	62336-24-7
Structure
Synonyms	2-(Diphenylphosphino)-1-Bromobenzene
IUPAC Name	(2-bromophenyl)-diphenylphosphane
Molecular Weight	341.19
Molecular Formula	C18H14BrP
InChI	XIONUQPOXCUMMB-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H14BrP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H
Boiling Point	405.0±28.0 °C(Predicted)
Melting Point	112-116 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3Br

Q&A

What is the molecular formula of 2-Bromophenyldiphenylphosphine?

The molecular formula of 2-Bromophenyldiphenylphosphine is C18H14BrP.

What is the exact mass of 2-Bromophenyldiphenylphosphine?

The exact mass of 2-Bromophenyldiphenylphosphine is 340.00165.

What is the IUPAC name of 2-Bromophenyldiphenylphosphine?

The IUPAC name of 2-Bromophenyldiphenylphosphine is (2-bromophenyl)-diphenylphosphane.

What is the InChIKey for 2-Bromophenyldiphenylphosphine?

The InChIKey for 2-Bromophenyldiphenylphosphine is XIONUQPOXCUMMB-UHFFFAOYSA-N.

What is the Canonical SMILES representation of 2-Bromophenyldiphenylphosphine?

The Canonical SMILES representation of 2-Bromophenyldiphenylphosphine is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3Br.

How many Heavy Atoms are present in 2-Bromophenyldiphenylphosphine?

There are 20 Heavy Atoms present in 2-Bromophenyldiphenylphosphine.

What is the Topological Polar Surface Area of 2-Bromophenyldiphenylphosphine?

The Topological Polar Surface Area of 2-Bromophenyldiphenylphosphine is 0.

How many Rotatable Bond Counts are there in 2-Bromophenyldiphenylphosphine?

There are 3 Rotatable Bond Counts in 2-Bromophenyldiphenylphosphine.

What is the CAS number of 2-Bromophenyldiphenylphosphine?

The CAS number of 2-Bromophenyldiphenylphosphine is 62336-24-7.

What are some depositor-supplied synonyms for 2-Bromophenyldiphenylphosphine?

Some depositor-supplied synonyms for 2-Bromophenyldiphenylphosphine are (2-Bromophenyl)diphenylphosphine, 2-BROMOPHENYLDIPHENYLPHOSPHINE, and 2-Diphenylphosphino-1-bromobenzene.