2-Bromo-1,10-phenanthroline

Catalog Number	ACM22426148-1
CAS	22426-14-8
Structure
Synonyms	1,10-Phenanthroline, 2-bromo-
IUPAC Name	2-bromo-1,10-phenanthroline
Molecular Weight	259.10
Molecular Formula	C12H7BrN2
Canonical SMILES	C1=CC2=C(C3=C(C=C2)C=CC(=N3)Br)N=C1
InChI	ZRJUDAZGVGIDLP-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H7BrN2/c13-10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10/h1-7H
Boiling Point	414.3±25.0 °C(Predicted)
Melting Point	161-165 °C
Purity	97%
Appearance	Solid
Complexity	234
Covalently-Bonded Unit Count	1
Exact Mass	257.97926
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	257.97926
Rotatable Bond Count	0
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of 2-Bromo-1,10-phenanthroline?

The molecular weight of 2-Bromo-1,10-phenanthroline is 259.1.

What are the product categories of 2-Bromo-1,10-phenanthroline?

The product categories of 2-Bromo-1,10-phenanthroline include oled intermediate.

What is the melting point range of 2-Bromo-1,10-phenanthroline?

The melting point range of 2-Bromo-1,10-phenanthroline is from 161.0 to 165.0 °C.

What is the density of 2-Bromo-1,10-phenanthroline?

The density of 2-Bromo-1,10-phenanthroline is 1.616.

What are some synonyms for 2-Bromo-1,10-phenanthroline?

Some synonyms for 2-Bromo-1,10-phenanthroline include 2-Bromo-1,10-phenathroline, 2-Bromo-1,10-phenant, 2-Bromo-1,10-phenthroline.

What are the safety statements associated with 2-Bromo-1,10-phenanthroline?

The safety statements associated with 2-Bromo-1,10-phenanthroline are 26-39.

How should 2-Bromo-1,10-phenanthroline be stored?

2-Bromo-1,10-phenanthroline should be kept in a dark place, sealed in a dry, at room temperature.

What is the InChIKey for 2-Bromo-1,10-phenanthroline?

The InChIKey for 2-Bromo-1,10-phenanthroline is ZRJUDAZGVGIDLP-UHFFFAOYS.

What is the boiling point range of 2-Bromo-1,10-phenanthroline?

The boiling point range of 2-Bromo-1,10-phenanthroline is 414.3±25.0 °C.

How can brominated phenanthroline be synthesized?

Brominated phenanthroline can be synthesized using a two-step protocol through N-Oxide formation using m-CBPA and bromination using TBAB and p-Toluenesulfonic anhydride.