2-(Benzylthio)-N-(2-morpholinoethyl)ethan-1-amine

Catalog Number	ACM1799787088
CAS	1799787-08-8
Synonyms	N-(2-Benzylsulfanylethyl)-2-morpholin-4-ylethanamine
IUPAC Name	N-(2-benzylsulfanylethyl)-2-morpholin-4-ylethanamine
Molecular Weight	280.43
Molecular Formula	C15H24N2OS
InChI	XPYCEOGTFFGNJN-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H24N2OS/c1-2-4-15(5-3-1)14-19-13-7-16-6-8-17-9-11-18-12-10-17/h1-5,16H,6-14H2
Purity	98%
Isomeric SMILES	C1COCCN1CCNCCSCC2=CC=CC=C2

Q&A

What are some synonyms for the compound 2-(Benzylthio)-N-(2-morpholinoethyl)ethan-1-amine?

Some synonyms for the compound are 4-Morpholineethanamine, N-[2-[(phenylmethyl)thio]ethyl]-.

What is the molecular formula of 2-(Benzylthio)-N-(2-morpholinoethyl)ethan-1-amine?

The molecular formula is C15H24N2OS.

What is the predicted boiling point of the compound?

The predicted boiling point is 418.7±40.0 °C.

What is the predicted pka value of the compound?

The predicted pka value is 9.33±0.19.

What is the predicted density of 2-(Benzylthio)-N-(2-morpholinoethyl)ethan-1-amine?

The predicted density is 1.082±0.06 g/cm3.

What is the molecular weight of 2-(Benzylthio)-N-(2-morpholinoethyl)ethan-1-amine?

The molecular weight is 280.43.

How many nitrogen atoms are present in the compound?

There are 2 nitrogen atoms present in the compound.

What is the molecular structure of 2-(Benzylthio)-N-(2-morpholinoethyl)ethan-1-amine?

The structure consists of a benzylthio group attached to an N-(2-morpholinoethyl)ethan-1-amine group.