2-(Benzo[d]thiazol-2-yl)-5-methylphenol

Catalog Number	ACM56048545-1
CAS	56048-54-5
Structure
Synonyms	2-(2-Hydroxy-4-Methylphenyl)Benzothiazole; Phenol,2-(2-Benzothiazolyl)-5-Methyl-; 2-(1,3-Benzothiazol-2-yl)-5-methylphenol
IUPAC Name	2-(1,3-benzothiazol-2-yl)-5-methylphenol
Molecular Weight	241.31
Molecular Formula	C14H11NOS
InChI	DILRSGGQTSJRST-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H11NOS/c1-9-6-7-10(12(16)8-9)14-15-11-4-2-3-5-13(11)17-14/h2-8,16H,1H3
Boiling Point	410.6±55.0 °C(Predicted)
Purity	98%
Isomeric SMILES	CC1=CC(=C(C=C1)C2=NC3=CC=CC=C3S2)O

Q&A

What is the molecular weight of the compound with CAS number 56048-54-5?

The molecular weight of the compound is 241.31.

What is the product name of the compound?

The product name is 2-(2-BENZOTHIAZOLYL)-5-METHYLPHENOL.

What are some synonyms for the compound?

Some synonyms for the compound are 2-(1,3-Benzothiazol-2-yl)-5-methylphenol, 2-(2-HYDROXY-4-METHYLPHENYL)BENZOTHIAZOLE, and 2-(2-BENZOTHIAZOLYL)-5-METHYLPHENOL.

What is the boiling point of the compound?

The boiling point is predicted to be 410.6±55.0 °C.

What is the predicted pka value of the compound?

The predicted pka value is 8.18±0.35.

What is the predicted density of the compound?

The predicted density is 1.295±0.06 g/cm3.

What is the molecular formula of the compound?

The molecular formula is C14H11NOS.

Are there any other names or identifiers for the compound?

Yes, some other identifiers include TIMTEC-BB SBB007905 and 2-(2-BENXOTHIAZOLYL)-5-METHYLPHENOL.

What is the predicted appearance of the compound?

The compound is predicted to be a white crystalline substance.