What is the molecular weight of (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
The molecular weight is 336.86g/mol.
What is the exact mass of (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
The exact mass is 337.1548223.
How many heavy atoms are present in (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
There are 20 heavy atoms present.
How many hydrogen bond acceptors are there in (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
There are 10 hydrogen bond acceptors.
What is the Canonical SMILES of (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
[B-](F)(F)(F)F.[B-](F)(F)(F)F.CC(C)[PH+](CC[NH3+])C(C)C
What is the InChIKey of (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
FRNNRBJVGVIOPD-UHFFFAOYSA-P
What is the IUPAC Name of (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
2-di(propan-2-yl)phosphaniumylethylazanium;ditetrafluoroborate
How many covalently-bonded units are present in (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
There are 3 covalently-bonded units.
What are the Depositor-Supplied Synonyms for (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate?
1222630-50-3, 2-(DI-I-PROPYLPHOSPHONIUM)ETHYLAMMONIUM BIS(TETRAFLUOROBORATE), (2-Ammonioethyl)diisopropylphosphoniumditetrafluoroborate, MFCD17018760, etc.
What is the Complexity of (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate based on the computed properties?
The complexity is 92.4.