(2-Ammonioethyl)di-t-butylphosphonium bis(tetrafluoroborate)

Catalog Number	ACMA00040897
Molecular Weight	364.90
Molecular Formula	C10H26B2F8NP
Purity	96%

Q&A

What is the molecular weight of (2-Ammonioethyl)DI-T-butylphosphonium bis(tetrafluoroborate)?

The molecular weight is 364.9g/mol.

What is the exact mass of (2-Ammonioethyl)DI-T-butylphosphonium bis(tetrafluoroborate)?

The exact mass is 365.1861225.

How many heavy atoms are present in the compound?

There are 22 heavy atoms.

How many hydrogen bond acceptors are present in the compound?

There are 10 hydrogen bond acceptors.

What is the canonical SMILES representation of the compound?

[B-](F)(F)(F)F.[B-](F)(F)(F)F.CC(C)(C)[PH+](CC[NH3+])C(C)(C)C

What is the InChIKey of (2-Ammonioethyl)DI-T-butylphosphonium bis(tetrafluoroborate)?

The InChIKey is MWVDZPSIELCQBF-UHFFFAOYSA-P.

How many covalently-bonded unit counts are present in the compound?

There are 3 covalently-bonded units.

What is the IUPAC name of the compound?

2-ditert-butylphosphaniumylethylazanium;ditetrafluoroborate

What are some of the synonyms of (2-Ammonioethyl)DI-T-butylphosphonium bis(tetrafluoroborate)?

Some synonyms include MFCD17018771, CS-0108146, E76922, and SY316413.