(2-Aminoethyl)diisopropylphosphonium tetrafluoroborate

Catalog Number	ACM1222630332
CAS	1222630-33-2
Synonyms	2-aminoethyl-di(propan-2-yl)phosphanium;tetrafluoroborate
IUPAC Name	2-aminoethyl-di(propan-2-yl)phosphanium;tetrafluoroborate
Molecular Weight	249.04
Molecular Formula	C8H21BF4NP
InChI	RGGVAIQJYAPYKM-UHFFFAOYSA-O
InChI Key	InChI=1S/C8H20NP.BF4/c1-7(2)10(6-5-9)8(3)4;2-1(3,4)5/h7-8H,5-6,9H2,1-4H3;/q;-1/p+1
Purity	97%
Isomeric SMILES	[B-](F)(F)(F)F.CC(C)[PH+](CCN)C(C)C

Q&A

What is the CAS number for (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

The CAS number is 1222630-33-2.

What is the canonical SMILES representation of (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

The canonical SMILES is [B-](F)(F)(F)F.CC(C)[PH+](CCN)C(C)C.

How many covalently-bonded units are there in (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

There are 2 covalently-bonded units.

What is the molecular weight of (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

The molecular weight is 249.04g/mol.

How many hydrogen bond acceptor counts are there in (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

There are 6 hydrogen bond acceptor counts.

What is the IUPAC name of (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

The IUPAC name is 2-aminoethyl-di(propan-2-yl)phosphanium;tetrafluoroborate.

What is the InChIKey for (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

The InChIKey is RGGVAIQJYAPYKM-UHFFFAOYSA-O.

How many heavy atoms are present in (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

There are 15 heavy atoms.

What is the topological polar surface area of (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

The topological polar surface area is 26.

What is the monoisotopic mass of (2-Aminoethyl)diisopropylphosphonium tetrafluoroborate?

The monoisotopic mass is 249.1440795.