2,9-Diphenyl-1,10-phenanthroline

Catalog Number	ACM25677694-1
CAS	25677-69-4
Structure
Synonyms	1,10-Phenanthroline, 2,9-diphenyl-
IUPAC Name	2,9-diphenyl-1,10-phenanthroline
Molecular Weight	332.40
Molecular Formula	C24H16N2
Canonical SMILES	C1=CC=C(C=C1)C2=NC3=C(C=CC4=C3N=C(C=C4)C5=CC=CC=C5)C=C2
InChI	HVCVRVKEIKXBIF-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H16N2/c1-3-7-17(8-4-1)21-15-13-19-11-12-20-14-16-22(18-9-5-2-6-10-18)26-24(20)23(19)25-21/h1-16H
Boiling Point	559.5 °C at 760 mmHg
Melting Point	186-190 °C
Purity	98%
Complexity	409
Covalently-Bonded Unit Count	1
Exact Mass	332.131348519
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	332.131348519
Rotatable Bond Count	2
Topological Polar Surface Area	25.8 Ų

Q&A

What is the CAS number for 2,9-Diphenyl-1,10-phenanthroline?

The CAS number for 2,9-Diphenyl-1,10-phenanthroline is 25677-69-4.

What is the molecular weight of 2,9-Diphenyl-1,10-phenanthroline?

The molecular weight of 2,9-Diphenyl-1,10-phenanthroline is 332.4.

What is the melting point of 2,9-Diphenyl-1,10-phenanthroline?

The melting point of 2,9-Diphenyl-1,10-phenanthroline is 186.0 to 190.0 °C.

What is the predicted density of 2,9-Diphenyl-1,10-phenanthroline?

The predicted density of 2,9-Diphenyl-1,10-phenanthroline is 1.210±0.06 g/cm3.

In what form does 2,9-Diphenyl-1,10-phenanthroline exist - powder or crystal?

2,9-Diphenyl-1,10-phenanthroline exists in the form of powder to crystal.

What is the color of 2,9-Diphenyl-1,10-phenanthroline?

The color of 2,9-Diphenyl-1,10-phenanthroline is white to yellow.

What is the predicted boiling point of 2,9-Diphenyl-1,10-phenanthroline?

The predicted boiling point of 2,9-Diphenyl-1,10-phenanthroline is 559.5±45.0 °C.

How should 2,9-Diphenyl-1,10-phenanthroline be stored?

2,9-Diphenyl-1,10-phenanthroline should be stored sealed in dry, at room temperature.

What is the predicted pka value of 2,9-Diphenyl-1,10-phenanthroline?

The predicted pka value of 2,9-Diphenyl-1,10-phenanthroline is 4.82±0.30.

What is the HS Code for 2,9-Diphenyl-1,10-phenanthroline?

The HS Code for 2,9-Diphenyl-1,10-phenanthroline is 29339900.