2,9-Dimethyl-1,10-phenanthroline hemihydrate

Catalog Number	ACM34302697-1
CAS	34302-69-7
Structure
Synonyms	Neocuproine hemihydrate
IUPAC Name	2,9-dimethyl-1,10-phenanthroline;hydrate
Molecular Weight	434.53
Molecular Formula	C28H26N4O
Canonical SMILES	CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C.CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C.O
InChI	IEBXFSLFDFHSRD-UHFFFAOYSA-N
InChI Key	InChI=1S/2C14H12N2.H2O/c2*1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h2*3-8H,1-2H3;1H2
Melting Point	159-164 °C
Purity	98%
Appearance	White crystalline powder
Exact Mass	434.21066147
Heavy Atom Count	33
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Monoisotopic Mass	434.21066147
Rotatable Bond Count	0
Topological Polar Surface Area	52.6 Ų

Q&A

What is the molecular weight of 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

The molecular weight of 2,9-Dimethyl-1,10-phenanthroline hemihydrate is 226.27.

What is the melting point of 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

The melting point of 2,9-Dimethyl-1,10-phenanthroline hemihydrate is 159-164 °C.

What is the solubility of 2,9-Dimethyl-1,10-phenanthroline hemihydrate in methanol?

The solubility of 2,9-Dimethyl-1,10-phenanthroline hemihydrate in methanol is 0.1 g/mL.

What is the color of 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

The color of 2,9-Dimethyl-1,10-phenanthroline hemihydrate is white.

What is the storage recommendation for 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

It is recommended to keep 2,9-Dimethyl-1,10-phenanthroline hemihydrate in a dark place, sealed in dry, at room temperature.

What are some synonyms for 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

Some synonyms for 2,9-Dimethyl-1,10-phenanthroline hemihydrate include 2,9-DIMETHYL-1,10-PHENANTHROLINE 0.5-WATER and NEOCUPROINE HYDRATE.

What are some hazard codes associated with 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

The hazard codes associated with 2,9-Dimethyl-1,10-phenanthroline hemihydrate are Xi and Xn.

What are the safety statements for 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

The safety statement for 2,9-Dimethyl-1,10-phenanthroline hemihydrate is 26.

What are some uses of 2,9-Dimethyl-1,10-phenanthroline hemihydrate?

2,9-Dimethyl-1,10-phenanthroline hemihydrate is used as an analytical reagent for the determination of copper and in medicine and chemical research.

How is 2,9-Dimethyl-1,10-phenanthroline hemihydrate used for the determination of copper?

2,9-Dimethyl-1,10-phenanthroline hemihydrate is used as a reagent for the spectrophotometric determination of copper in water-ethanol solution using thermal-lens spectrometry.