2,9-Dichloro-1,10-phenanthroline

Catalog Number	ACM29176554-1
CAS	29176-55-4
Structure
Synonyms	2,9-Dichloro-o-phenanthroline
IUPAC Name	2,9-dichloro-1,10-phenanthroline
Molecular Weight	249.09
Molecular Formula	C12H6Cl2N2
Canonical SMILES	C1=CC2=C(C3=C1C=CC(=N3)Cl)N=C(C=C2)Cl
InChI	DNKGIDURJINUOA-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H6Cl2N2/c13-9-5-3-7-1-2-8-4-6-10(14)16-12(8)11(7)15-9/h1-6H
Boiling Point	249-250 °C
Melting Point	249-250 °C
Purity	96%
Density	Air Sensitive
Appearance	Yellowish powder
Storage	Store under inert gas
Complexity	235
Covalently-Bonded Unit Count	1
Exact Mass	247.9908036
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
MDL Number	MFCD02084186
Monoisotopic Mass	247.9908036
Rotatable Bond Count	0
Topological Polar Surface Area	25.8 Ų

Q&A

What is the chemical formula of 2,9-Dichloro-1,10-phenanthroline?

The chemical formula of 2,9-Dichloro-1,10-phenanthroline is C12H6Cl2N2.

What is the molecular weight of 2,9-Dichloro-1,10-phenanthroline?

The molecular weight of 2,9-Dichloro-1,10-phenanthroline is 249.1.

What are some synonyms of 2,9-Dichloro-1,10-phenanthroline?

Some synonyms of 2,9-Dichloro-1,10-phenanthroline are 1,10-Phenanthroline,2,9-dichloro; 2,9-Dichloro-o-phenanthroline; NSC 608430; VUF 7732; and more.

What is the melting point of 2,9-Dichloro-1,10-phenanthroline?

The melting point of 2,9-Dichloro-1,10-phenanthroline is 249-250°C.

What is the color of 2,9-Dichloro-1,10-phenanthroline?

The color of 2,9-Dichloro-1,10-phenanthroline is white to light yellow.

How should 2,9-Dichloro-1,10-phenanthroline be stored?

2,9-Dichloro-1,10-phenanthroline should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted boiling point of 2,9-Dichloro-1,10-phenanthroline?

The predicted boiling point of 2,9-Dichloro-1,10-phenanthroline is 417.3±40.0°C.

What is the predicted pka value of 2,9-Dichloro-1,10-phenanthroline?

The predicted pka value of 2,9-Dichloro-1,10-phenanthroline is 2.56±0.30.

What is the HS Code for 2,9-Dichloro-1,10-phenanthroline?

The HS Code for 2,9-Dichloro-1,10-phenanthroline is 2933.99.8290.

In what form does 2,9-Dichloro-1,10-phenanthroline come in?

2,9-Dichloro-1,10-phenanthroline comes in the form of powder to crystal.