2,9-Dibutyl-1,10-phenanthroline

Catalog Number	ACM85575935-2
CAS	85575-93-5
Structure
Synonyms	CTK3C8587; ZINC39630908; AKOS015839707; ANW-38212; DTXSID90538988; LSGGPELKXXFMGO-UHFFFAOYSA-N; ACMC-209q6u; 1,10-Phenanthroline, 2,9-dibutyl-; 85575-93-5;
IUPAC Name	2,9-dibutyl-1,10-phenanthroline
Molecular Weight	292.42
Molecular Formula	C20H24N2
Canonical SMILES	CCCCC1=NC2=C(C=CC3=C2N=C(C=C3)CCCC)C=C1
InChI	LSGGPELKXXFMGO-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H24N2/c1-3-5-7-17-13-11-15-9-10-16-12-14-18(8-6-4-2)22-20(16)19(15)21-17/h9-14H,3-8H2,1-2H3
Boiling Point	428.6±40.0 °C(Predicted)
Melting Point	58 °C
Purity	98%
Complexity	298
Covalently-Bonded Unit Count	1
Exact Mass	292.193948774
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	292.193948774
Rotatable Bond Count	6
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of 2,9-Dibutyl-1,10-phenanthroline?

The molecular weight of 2,9-Dibutyl-1,10-phenanthroline is 292.42.

What are some synonyms for 2,9-Dibutyl-1,10-phenanthroline?

Some synonyms for 2,9-Dibutyl-1,10-phenanthroline are Dibutylphenanthroline, 2,9-dibutyl-1,10-phenanthroline, and 1,10-Phenanthroline, 2,9-dibutyl-.

What is the melting point of 2,9-Dibutyl-1,10-phenanthroline?

The melting point of 2,9-Dibutyl-1,10-phenanthroline is 58°C.

What is the density of 2,9-Dibutyl-1,10-phenanthroline predicted to be?

The predicted density of 2,9-Dibutyl-1,10-phenanthroline is 1.060±0.06 g/cm3.

In what form does 2,9-Dibutyl-1,10-phenanthroline come?

2,9-Dibutyl-1,10-phenanthroline comes in a form of powder to crystal.

What color does 2,9-Dibutyl-1,10-phenanthroline appear in?

2,9-Dibutyl-1,10-phenanthroline appears in the colors white to orange to green.

What is the predicted boiling point of 2,9-Dibutyl-1,10-phenanthroline?

The predicted boiling point of 2,9-Dibutyl-1,10-phenanthroline is 428.6±40.0 °C.

How should 2,9-Dibutyl-1,10-phenanthroline be stored?

2,9-Dibutyl-1,10-phenanthroline should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted pka value of 2,9-Dibutyl-1,10-phenanthroline?

The predicted pka value of 2,9-Dibutyl-1,10-phenanthroline is 6.04±0.30.

What safety statements are associated with 2,9-Dibutyl-1,10-phenanthroline?

The safety statement associated with 2,9-Dibutyl-1,10-phenanthroline is 24/25.