2,6-Di(1H-1,2,4-triazol-1-yl)pyridine

Catalog Number	ACM39242187-2
CAS	39242-18-7
Synonyms	2,6-Bis(1,2,4-triazol-1yl)pyridine
IUPAC Name	2,6-bis(1,2,4-triazol-1-yl)pyridine
Molecular Weight	213.20
Molecular Formula	C9H7N7
InChI	MFOIBUMMJBNCGI-UHFFFAOYSA-N
InChI Key	InChI=1S/C9H7N7/c1-2-8(15-6-10-4-12-15)14-9(3-1)16-7-11-5-13-16/h1-7H
Purity	95%
Isomeric SMILES	C1=CC(=NC(=C1)N2C=NC=N2)N3C=NC=N3

Q&A

What is the chemical compound with the CAS number 39242-18-7?

The chemical compound is 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine.

What is the molecular weight of 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine?

The molecular weight is 213.2.

What are some synonyms for 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine?

Some synonyms include 2,6-bis(1,2,4-triazol-1yl)pyridine, (2-METHOXYPHENYL)(1-PIPERAZINYL)METHANONE, Pyridine, 2,6-bis(1H-1,2,4-triazol-1-yl)-, and DK7360.

How can 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine be stored?

It can be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the chemical formula of 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine?

The chemical formula is C9H7N7.

What is the product name of 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine?

The product name is 2,6-bis(1,2,4-triazol-1yl)pyridine.

What are the possible storage conditions for 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine?

The possible storage conditions are under inert gas at 2-8°C.

What is another name for 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine?

Another name is 2,6-bis(1,2,4-triazol-1yl)pyridine.