2,6-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)pyridine

Catalog Number	ACM118949625
CAS	118949-62-5
Structure
Synonyms	Pyridine, 2,6-bis[(4S)-4,5-dihydro-4-[(1S)-1-methylpropyl]-2-oxazolyl]-
IUPAC Name	4-butan-2-yl-2-[6-(4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyridin-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight	329.44
Molecular Formula	C19H27N3O2
InChI	LFHBTGPZRLYINH-UHFFFAOYSA-N
InChI Key	InChI=1S/C19H27N3O2/c1-5-12(3)16-10-23-18(21-16)14-8-7-9-15(20-14)19-22-17(11-24-19)13(4)6-2/h7-9,12-13,16-17H,5-6,10-11H2,1-4H3
Purity	97%
Isomeric SMILES	CCC(C)C1COC(=N1)C2=NC(=CC=C2)C3=NC(CO3)C(C)CC

Q&A

What is the molecular weight of 2,6-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)pyridine?

The molecular weight is 329.44.

What is the CAS number for this compound?

The CAS number is 118949-62-5.

What are some synonyms for 2,6-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)pyridine?

Some synonyms include Pyridine, 2,6-bis[(4S)-4,5-dihydro-4-[(1S)-1-methylpropyl]-2-oxazolyl].

What is the chemical formula for 2,6-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)pyridine?

The chemical formula is C19H27N3O2.

Is the compound optically active?

Yes, the compound is optically active.

What is the stereochemistry of the compound?

The compound has a (S)-configuration for both the sec-butyl and dihydrooxazol groups.

What functional groups are present in the molecule?

The molecule contains a pyridine ring, two dihydrooxazol groups, and a sec-butyl group.

What is the systematic name for this compound?

The systematic name is 2,6-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)pyridine.

How many chiral centers are present in the compound?

There are two chiral centers in the compound.

What is the IUPAC name for this compound?

The IUPAC name is (2S,6S)-2,6-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)pyridine.