What is the molecular formula of 2,6-Bis(diphenylphosphino)-N,N-diethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The molecular formula is C48H40NO2P3.
What is the molecular weight of 2,6-Bis(diphenylphosphino)-N,N-diethyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine?
The molecular weight is 755.8g/mol.
How many hydrogen bond acceptors does the compound have?
It has 3 hydrogen bond acceptors.
What is the XLogP3 value of the compound?
The XLogP3 value is 12.2.
What is the InChIKey of the compound?
The InChIKey is DYSGCUQLESLTBJ-UHFFFAOYSA-N.
How many rotatable bonds does the compound have?
It has 9 rotatable bonds.
What is the canonical SMILES representation of the compound?
The canonical SMILES is CCN(CC)P1OC2=C(C3=CC=CC=C3C=C2P(C4=CC=CC=C4)C5=CC=CC=C5)C6=C(O1)C(=CC7=CC=CC=C76)P(C8=CC=CC=C8)C9=CC=CC=C9.
What is the exact mass of the compound?
The exact mass is 755.22719051.
How many covalently-bonded units are there in the compound?
There is 1 covalently-bonded unit.
What is the IUPAC name of the compound?
The IUPAC name is 10,16-bis(diphenylphosphanyl)-N,N-diethyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
