What is the molecular formula of 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
The molecular formula is C19H35NP2.
What is the exact mass of 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
The exact mass is 339.22447412.
How many hydrogen bond acceptor counts does 2,6-Bis[(diisopropylphosphino)methyl]pyridine have?
It has 1 hydrogen bond acceptor count.
What is the Canonical SMILES notation for 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
CC(C)P(CC1=NC(=CC=C1)CP(C(C)C)C(C)C)C(C)C
What is the IUPAC Name of 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
[6-[di(propan-2-yl)phosphanylmethyl]pyridin-2-yl]methyl-di(propan-2-yl)phosphane
How many rotatable bond counts does 2,6-Bis[(diisopropylphosphino)methyl]pyridine have?
It has 8 rotatable bond counts.
What is the Computed Properties Heavy Atom Count of 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
The Heavy Atom Count is 22.
What is the InChIKey for 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
The InChIKey is ISALXWZSPYRWEM-UHFFFAOYSA-N.
What is the topological polar surface area of 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
The topological polar surface area is 12.9.
What is the Depositor-Supplied Synonym for 2,6-Bis[(diisopropylphosphino)methyl]pyridine?
One of the synonyms is 2,6-bis((diisopropylphosphino)methyl)pyridine.