2,5-Dimethylstyrene

Catalog Number	ACM2039896-2
CAS	2039-89-6
Structure
Synonyms	1,4-Dimethyl-2-vinylbenzene; 2-Ethenyl-1,4-dimethylbenzene
IUPAC Name	2-ethenyl-1,4-dimethylbenzene
Molecular Weight	132.21
Molecular Formula	C10H12
Canonical SMILES	Cc1ccc(C)c(C=C)c1
InChI	DBWWINQJTZYDFK-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H12/c1-4-10-7-8(2)5-6-9(10)3/h4-7H,1H2,2-3H3
Boiling Point	71-72 °C at 10 mmHg(lit.)
Melting Point	-35 °C(lit.)
Flash Point	147 °F
Purity	97%
Density	0.904 g/cm3 at 25 °C(lit.)
Application	This product is suitable for scientific research.
EC Number	218-028-9
Exact Mass	132.09400
Isomeric SMILES	CC1=CC(=C(C=C1)C)C=C
MDL Number	MFCD00008614
PubChem ID	24862020

Q&A

What is the product name of the chemical with CAS number 2039-89-6?

The product name is 2,5-Dimethylstyrene.

What is the molecular weight of 2,5-Dimethylstyrene?

The molecular weight is 132.21.

What is the molecular formula of 2,5-Dimethylstyrene?

The molecular formula is C10H12.

What is the boiling point of 2,5-Dimethylstyrene?

The boiling point is 71-72 °C at 10 mmHg.

What is the purity of 2,5-Dimethylstyrene?

The purity is 97%.

What application is 2,5-Dimethylstyrene suitable for?

This product is suitable for scientific research.

What is the density of 2,5-Dimethylstyrene at 25 °C?

The density is 0.904 g/cm3 at 25 °C.

What is the EC number of 2,5-Dimethylstyrene?

The EC number is 218-028-9.

What are the features and benefits of 2,5-Dimethylstyrene?

The features and benefits include high-quality products, fast delivery, and the option to order additional products.

What is the refractive index of 2,5-Dimethylstyrene?

The refractive index is n20/D 1.539.