2,4-Diphenylpyridine

Catalog Number	ACM26274351-1
CAS	26274-35-1
Structure
Synonyms	Pyridine, 2,4-diphenyl-
IUPAC Name	2,4-diphenylpyridine
Molecular Weight	231.29
Molecular Formula	C17H13N
Canonical SMILES	C1=CC=C(C=C1)C2=CC(=NC=C2)C3=CC=CC=C3
InChI	YASXBDJBCBUIHT-UHFFFAOYSA-N
InChI Key	InChI=1S/C17H13N/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15/h1-13H
Melting Point	68 °C
Purity	98%+
Density	1.084g/cm³
Appearance	Solid
Complexity	238
Covalently-Bonded Unit Count	1
Exact Mass	231.104799g/mol
Formal Charge	0
Heavy Atom Count	18
Isomeric SMILES	C1=CC=C(C=C1)C2=CC(=NC=C2)C3=CC=CC=C3
Monoisotopic Mass	231.104799g/mol
Rotatable Bond Count	2

Q&A

What is the chemical formula for 2,4-Diphenylpyridine?

The chemical formula for 2,4-Diphenylpyridine is C17H13N.

What is the molecular weight of 2,4-Diphenylpyridine?

The molecular weight of 2,4-Diphenylpyridine is 231.29 g/mol.

What is the CAS number for 2,4-Diphenylpyridine?

The CAS number for 2,4-Diphenylpyridine is 26274-35-1.

At what temperature does 2,4-Diphenylpyridine melt?

2,4-Diphenylpyridine melts at 68 °C.

What is the predicted density of 2,4-Diphenylpyridine?

The predicted density of 2,4-Diphenylpyridine is 1.084 ± 0.06 g/cm3.

What is the color of 2,4-Diphenylpyridine in powder to crystal form?

The color of 2,4-Diphenylpyridine is white to light yellow.

At what temperature does 2,4-Diphenylpyridine boil?

2,4-Diphenylpyridine boils at 376.4 ± 11.0°C.

How should 2,4-Diphenylpyridine be stored?

2,4-Diphenylpyridine should be sealed in dry conditions at room temperature.

What is the predicted pKa value of 2,4-Diphenylpyridine?

The predicted pKa value of 2,4-Diphenylpyridine is 4.56 ± 0.10.

What is the HS Code for 2,4-Diphenylpyridine?

The HS Code for 2,4-Diphenylpyridine is 2933.39.9001.