2,4,7,9-Tetrachloro-1,10-phenanthroline

Catalog Number	ACM167946487
CAS	167946-48-7
IUPAC Name	2,4,7,9-tetrachloro-1,10-phenanthroline
Molecular Weight	317.99
Molecular Formula	C12H4Cl4N2
InChI	RAMXIGMUGBXNSY-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H4Cl4N2/c13-7-3-9(15)17-11-5(7)1-2-6-8(14)4-10(16)18-12(6)11/h1-4H
Purity	98%
Isomeric SMILES	C1=CC2=C(C3=C1C(=CC(=N3)Cl)Cl)N=C(C=C2Cl)Cl

Q&A

What is the molecular weight of 2,4,7,9-Tetrachloro-1,10-phenanthroline?

The molecular weight is 317.99.

What is another name for 2,4,7,9-Tetrachloro-1,10-phenanthroline?

It is also known as 1,10-Phenanthroline, 2,4,7,9-tetrachloro-

What is the molecular formula of 2,4,7,9-Tetrachloro-1,10-phenanthroline?

The molecular formula is C12H4Cl4N2.

What is the predicted boiling point of 2,4,7,9-Tetrachloro-1,10-phenanthroline?

The predicted boiling point is 443.4±40.0 °C.

What is the predicted pka value of 2,4,7,9-Tetrachloro-1,10-phenanthroline?

The predicted pka value is 1.67±0.30.

What is the predicted density of 2,4,7,9-Tetrachloro-1,10-phenanthroline?

The predicted density is 1.656±0.06 g/cm3.

What is the Chemical Abstracts Service (CAS) number for 2,4,7,9-Tetrachloro-1,10-phenanthroline?

The CAS number is 167946-48-7.

How many chlorine atoms are present in the compound?

There are four chlorine atoms present.

What is the number of nitrogen atoms in the compound?

There are two nitrogen atoms present.