2-(4,5-Dihydrooxazol-2-yl)phenol

Catalog Number	ACM20237927
CAS	20237-92-7
Synonyms	2-(2-Hydroxyphenyl)-2-Oxazoline; 2-Hydroxyphenyloxazoline; 2-(2-Oxazoline-2-Yl)Phenol
IUPAC Name	2-(4,5-dihydro-1,3-oxazol-2-yl)phenol
Molecular Weight	163.17
Molecular Formula	C9H9NO2
InChI	FETLPNKZRXDWLT-UHFFFAOYSA-N
InChI Key	InChI=1S/C9H9NO2/c11-8-4-2-1-3-7(8)9-10-5-6-12-9/h1-4,11H,5-6H2
Purity	97%
Isomeric SMILES	C1COC(=N1)C2=CC=CC=C2O

Q&A

What is the CAS number for 2-(4,5-Dihydrooxazol-2-yl)phenol compound?

CAS number is 20237-92-7.

What is the molecular weight of the compound?

The molecular weight is 163.17.

What is the product name of the compound?

The product name is 2-(2-Hydroxyphenyl)-2-oxazoline.

What are the synonyms for 2-(4,5-Dihydrooxazol-2-yl)phenol compound?

The synonyms are 2-(2-Hydroxyphenyl)-2-oxazoline and Phenol, 2-(4,5-dihydro-2-oxazolyl)-.

What is the molecular formula of the compound?

The molecular formula is C9H9NO2.

What is the predicted boiling point of the compound?

The predicted boiling point is 306.6±25.0 °C.

What is the predicted pka value of the compound?

The predicted pka value is 9.29±0.35.

What is the predicted density of the compound?

The predicted density is 1.26±0.1 g/cm3.

What functional groups are present in 2-(4,5-Dihydrooxazol-2-yl)phenol compound?

The compound contains a hydroxyl group (OH) and an oxazoline ring.