ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2-(4,5-Dihydro-2-oxazolyl)quinoline

Catalog Number ACM202191126-1
CAS 202191-12-6
Structure {[CurrentData.Name]}
Synonyms 2-(Quinolin-2-yl)-4,5-dihydrooxazole
IUPAC Name 2-quinolin-2-yl-4,5-dihydro-1,3-oxazole
Molecular Weight 198.22
Molecular Formula C12H10N2O
Canonical SMILES C1COC(=N1)C2=NC3=CC=CC=C3C=C2
InChI USDSJWOYSHFPND-UHFFFAOYSA-N
InChI Key InChI=1S/C12H10N2O/c1-2-4-10-9(3-1)5-6-11(14-10)12-13-7-8-15-12/h1-6H,7-8H2
Boiling Point 380.2±15.0 °C(Predicted)
Melting Point 109-110 °C
Purity 96%
Complexity 264
Covalently-Bonded Unit Count 1
Exact Mass 198.079312947
Heavy Atom Count 15
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Monoisotopic Mass 198.079312947
Rotatable Bond Count 1
Topological Polar Surface Area 34.5 Ų
Q&A

What is the CAS number for 2-(4,5-Dihydro-2-oxazolyl)quinoline?

The CAS number is 202191-12-6.

What is the molecular weight of 2-(4,5-Dihydro-2-oxazolyl)quinoline?

The molecular weight is 198.22.

What is the product name of 2-(4,5-Dihydro-2-oxazolyl)quinoline 97%?

The product name is 2-(4,5-Dihydro-2-oxazolyl)quinoline 97%.

What are some synonyms for 2-(4,5-Dihydro-2-oxazolyl)quinoline?

Some synonyms are 2-(quinolin-2-yl)-4,5-dihydrooxazole and 2-(quinolin-2-yl)-4,5-dihydro-1,3-oxazole.

What is the melting point of 2-(4,5-Dihydro-2-oxazolyl)quinoline?

The melting point is 109-110 °C.

What is the density of 2-(4,5-Dihydro-2-oxazolyl)quinoline?

The predicted density is 1.26±0.1 g/cm3.

What is the predicted pka of 2-(4,5-Dihydro-2-oxazolyl)quinoline?

The predicted pka is 3.27±0.61.

What is the predicted boiling point of 2-(4,5-Dihydro-2-oxazolyl)quinoline?

The predicted boiling point is 380.2±15.0 °C.

How should 2-(4,5-Dihydro-2-oxazolyl)quinoline be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What hazard codes, safety statements, and risk statements are associated with 2-(4,5-Dihydro-2-oxazolyl)quinoline?

The hazard code is Xi, safety statement is 26, and risk statements are 36/38.

Please kindly note that our products and services are for research use only.