2-(4-(2-(4,4-Dimethyl-4,5-dihydrooxazol-2-yl)naphthalen-1-yl)phenyl)-4,4-Dimethyl-4,5-dihydrooxazole

Catalog Number	ACM85678984
CAS	85678-98-4
Synonyms	2-[4-[2-(4,4-Dimethyl-5H-1,3-oxazol-2-yl)naphthalen-1-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole
IUPAC Name	2-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)naphthalen-1-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole
Molecular Weight	398.50
Molecular Formula	C26H26N2O2
InChI	FXLQSOSEGNFODX-UHFFFAOYSA-N
InChI Key	InChI=1S/C26H26N2O2/c1-25(2)15-29-23(27-25)19-11-9-18(10-12-19)22-20-8-6-5-7-17(20)13-14-21(22)24-28-26(3,4)16-30-24/h5-14H,15-16H2,1-4H3
Purity	98%
Isomeric SMILES	CC1(COC(=N1)C2=CC=C(C=C2)C3=C(C=CC4=CC=CC=C43)C5=NC(CO5)(C)C)C

Q&A

What is the CAS number of the compound?

The CAS number of the compound is 85678-98-4.

What is the molecular weight of the compound?

The molecular weight of the compound is 398.5.

What is the product name of the compound?

The product name of the compound is Oxazole, 2-[4-[2-(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-1-naphthalenyl]phenyl]-4,5-dihydro-4,4-dimethyl-.

What are the synonyms of the compound?

The synonyms of the compound are Oxazole, 2-[4-[2-(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-1-naphthalenyl]phenyl]-4,5-dihydro-4,4-dimethyl- and 2-(4-(2-(4,4-Dimethyl-4,5-dihydrooxazol-2-yl)naphthalen-1-yl)phenyl)-4,4-Dimethyl-4,5-dihydrooxazole.

What is the molecular formula of the compound?

The molecular formula of the compound is C26H26N2O2.

What is the predicted boiling point of the compound?

The predicted boiling point of the compound is 549.4±43.0 °C.

What is the predicted pKa value of the compound?

The predicted pKa value of the compound is 4.54±0.70.

What is the predicted density of the compound?

The predicted density of the compound is 1.17±0.1 g/cm3.

How many naphthalenyl groups are present in the compound?

There is one naphthalenyl group present in the compound.

What is the predicted molecular weight of the compound?

The predicted molecular weight of the compound is 398.5.