2,3-Diphenylquinoxaline

Catalog Number	ACM1684146-1
CAS	1684-14-6
Structure
Synonyms	2,3-Diphenyl-1,4-quinoxaline
IUPAC Name	2,3-diphenylquinoxaline
Molecular Weight	282.34
Molecular Formula	C20H14N2
InChI	RSNQVABHABAKEZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H14N2/c1-3-9-15(10-4-1)19-20(16-11-5-2-6-12-16)22-18-14-8-7-13-17(18)21-19/h1-14H
Melting Point	125-128 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)C2=NC3=CC=CC=C3N=C2C4=CC=CC=C4

Q&A

What is the CAS number for 2,3-Diphenylquinoxaline?

The CAS number for 2,3-Diphenylquinoxaline is 1684-14-6.

What is the molecular weight of 2,3-Diphenylquinoxaline?

The molecular weight of 2,3-Diphenylquinoxaline is 282.34.

What are the product categories that 2,3-Diphenylquinoxaline belongs to?

2,3-Diphenylquinoxaline belongs to the product categories Building Blocks, Heterocyclic Building Blocks, Heterocycles, and Quinoxalines.

What is the melting point of 2,3-Diphenylquinoxaline?

The melting point of 2,3-Diphenylquinoxaline is 125-128°C.

What is the storage temperature recommended for 2,3-Diphenylquinoxaline?

It is recommended to store 2,3-Diphenylquinoxaline sealed in dry, at room temperature.

What is the color of 2,3-Diphenylquinoxaline?

The color of 2,3-Diphenylquinoxaline is white to light yellow to light orange.

Is 2,3-Diphenylquinoxaline soluble in water?

No, 2,3-Diphenylquinoxaline is insoluble in water.

What are the hazard codes associated with 2,3-Diphenylquinoxaline?

The hazard codes associated with 2,3-Diphenylquinoxaline are Xi.

What is the chemical property of 2,3-Diphenylquinoxaline?

The chemical property of 2,3-Diphenylquinoxaline is a light beige or grey solid.

Where can one find the synthesis references for 2,3-Diphenylquinoxaline?

The synthesis references for 2,3-Diphenylquinoxaline can be found in Tetrahedron Letters, 17, p. 2347, 1976 DOI: 10.1016/S0040-4039(00)78773-9.