2,3-Diphenylpyridine

Catalog Number	ACM33421533-1
CAS	33421-53-3
Structure
Synonyms	Pyridine, 2,3-diphenyl-
IUPAC Name	2,3-diphenylpyridine
Molecular Weight	231.29
Molecular Formula	C17H13N
Canonical SMILES	C1=CC=C(C=C1)C2=C(N=CC=C2)C3=CC=CC=C3
InChI	WKAXDAMWMOBXMP-UHFFFAOYSA-N
InChI Key	InChI=1S/C17H13N/c1-3-8-14(9-4-1)16-12-7-13-18-17(16)15-10-5-2-6-11-15/h1-13H
Boiling Point	348.1ºC at 760mmHg
Melting Point	54-57 °C
Flash Point	149ºC
Purity	95%+
Density	1.084g/cm³
EC Number	251-511-2
Exact Mass	231.10500
Isomeric SMILES	C1=CC=C(C=C1)C2=C(N=CC=C2)C3=CC=CC=C3

Q&A

What is the molecular weight of 2,3-Diphenylpyridine?

The molecular weight of 2,3-Diphenylpyridine is 231.29.

What are the synonyms for 2,3-Diphenylpyridine?

The synonyms for 2,3-Diphenylpyridine are RARECHEM AQ NN 0177 and Pyridine, 2,3-diphenyl.

What is the chemical formula for 2,3-Diphenylpyridine?

The chemical formula for 2,3-Diphenylpyridine is C17H13N.

What is the EINECS number for 2,3-Diphenylpyridine?

The EINECS number for 2,3-Diphenylpyridine is 251-511-2.

What is the melting point of 2,3-Diphenylpyridine?

The melting point of 2,3-Diphenylpyridine is 54-57 °C.

What is the predicted density of 2,3-Diphenylpyridine?

The predicted density of 2,3-Diphenylpyridine is 1.084±0.06 g/cm3.

What is the predicted pka value of 2,3-Diphenylpyridine?

The predicted pka value of 2,3-Diphenylpyridine is 4.06±0.10.

What is the predicted boiling point of 2,3-Diphenylpyridine?

The predicted boiling point of 2,3-Diphenylpyridine is 348.1±11.0 °C.

How should 2,3-Diphenylpyridine be stored?

2,3-Diphenylpyridine should be stored at 2-8°C.

What is the CAS number for 2,3-Diphenylpyridine?

The CAS number for 2,3-Diphenylpyridine is 33421-53-3.