What is the CAS number for 2,3-Bis-(diphenylphosphino)butane?
The CAS number for 2,3-Bis-(diphenylphosphino)butane is 64896-28-2.
What is the molecular formula of 2,3-Bis-(diphenylphosphino)butane?
The molecular formula of 2,3-Bis-(diphenylphosphino)butane is C28H28P2.
How many heavy atoms are present in 2,3-Bis-(diphenylphosphino)butane?
There are 30 heavy atoms present in 2,3-Bis-(diphenylphosphino)butane.
What is the IUPAC name of 2,3-Bis-(diphenylphosphino)butane?
The IUPAC name of 2,3-Bis-(diphenylphosphino)butane is [(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane.
What is the molecular weight of 2,3-Bis-(diphenylphosphino)butane?
The molecular weight of 2,3-Bis-(diphenylphosphino)butane is 426.5g/mol.
How many rotatable bond counts are there in 2,3-Bis-(diphenylphosphino)butane?
There are 7 rotatable bond counts in 2,3-Bis-(diphenylphosphino)butane.
What is the Canonical SMILES representation of 2,3-Bis-(diphenylphosphino)butane?
The Canonical SMILES representation of 2,3-Bis-(diphenylphosphino)butane is CC(C(C)P(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4.
What is the XLogP3 value of 2,3-Bis-(diphenylphosphino)butane?
The XLogP3 value of 2,3-Bis-(diphenylphosphino)butane is 6.7.
What is the InChIKey of 2,3-Bis-(diphenylphosphino)butane?
The InChIKey of 2,3-Bis-(diphenylphosphino)butane is FWXAUDSWDBGCMN-ZEQRLZLVSA-N.
What are some of the Depositor-Supplied Synonyms for 2,3-Bis-(diphenylphosphino)butane?
Some of the Depositor-Supplied Synonyms for 2,3-Bis-(diphenylphosphino)butane are Chiraphos, (S,S)-, (-)-Chiraphos, and AS-66578.
