2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)

Catalog Number	ACM40875874
CAS	40875-87-4
Synonyms	2,5-Bis(5-Phenyl-2-Oxazolyl)Pyridine; 5-Phenyl-2-[5-(5-phenyl-1,3-oxazol-2-yl)pyridin-2-yl]-1,3-oxazole
IUPAC Name	5-phenyl-2-[5-(5-phenyl-1,3-oxazol-2-yl)pyridin-2-yl]-1,3-oxazole
Molecular Weight	365.38
Molecular Formula	C23H15N3O2
InChI	IXNDQJVRGBIWIE-UHFFFAOYSA-N
InChI Key	InChI=1S/C23H15N3O2/c1-3-7-16(8-4-1)20-14-25-22(27-20)18-11-12-19(24-13-18)23-26-15-21(28-23)17-9-5-2-6-10-17/h1-15H
Purity	98%
Isomeric SMILES	C1=CC=C(C=C1)C2=CN=C(O2)C3=CN=C(C=C3)C4=NC=C(O4)C5=CC=CC=C5

Q&A

What is the CAS number of the compound containing 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The CAS number of the compound is 40875-87-4.

What is the molecular weight of the compound containing 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The molecular weight of the compound is 365.38.

What is the product name of the compound containing 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The product name is Pyridine, 2,5-bis(5-phenyl-2-oxazolyl)-.

What are the synonyms of the compound containing 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The synonyms of the compound are Pyridine, 2,5-bis(5-phenyl-2-oxazolyl)- and 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole).

How is the compound with 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole) represented by its molecular formula?

The compound is represented by the molecular formula C23H15N3O2.

What is the chemical structure of the compound containing 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The compound contains a pyridine core with two 5-phenyl-2-oxazolyl groups attached at the 2 and 5 positions.

What is the molecular formula of the compound with 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The molecular formula is C23H15N3O2.

What functional groups are present in the compound containing 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The compound contains a pyridine ring and phenyloxazole groups.

What is the significance of 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole) in the compound's structure?

The compound refers to the linkage between the two 5-phenyl-2-oxazolyl groups in the compound's structure.

What are the potential applications of the compound with 2,2'-(Pyridine-2,5-diyl)bis(5-phenyloxazole)?

The compound may have applications in the field of organic synthesis or materials science due to its unique structure containing a pyridine core and phenyloxazole groups.