2,2'-(Ethane-1,2-diylidenebis(azanylylidene))diphenol

Catalog Number	ACM1149162
CAS	1149-16-2
Structure
Synonyms	Glyoxalbis(2-hydroxyanil)
IUPAC Name	2-[2-(2-hydroxyphenyl)iminoethylideneamino]phenol
Molecular Weight	240.26
Molecular Formula	C14H12N2O2
InChI	FZKAPSZEPRQQGK-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H12N2O2/c17-13-7-3-1-5-11(13)15-9-10-16-12-6-2-4-8-14(12)18/h1-10,17-18H
Boiling Point	414 °C at 760 mmHg
Purity	98%
Appearance	Light yellow solid
Isomeric SMILES	C1=CC=C(C(=C1)N=CC=NC2=CC=CC=C2O)O

Q&A

What is the molecular weight of Glyoxalbis(2-hydroxyanil)?

The molecular weight is 240.26

What is another name for Glyoxalbis(2-hydroxyanil)?

Another name is CALCIUM RED

What is the melting point of Glyoxalbis(2-hydroxyanil)?

The melting point is 203-211 °C

In what form is Glyoxalbis(2-hydroxyanil usually found?

It is found in the form of fine powder

What color is Glyoxalbis(2-hydroxyanil?

It is light yellow in color

What is the boiling point of Glyoxalbis(2-hydroxyanil?

The boiling point is 382.97 °C

In which solvents is Glyoxalbis(2-hydroxyanil slightly soluble?

It is slightly soluble in chloroform, DMSO, ethyl acetate, and methanol

What is the predicted pka of Glyoxalbis(2-hydroxyanil?

The predicted pka is 9.46±0.35

What hazard code is associated with Glyoxalbis(2-hydroxyanil?

The hazard code is Xi

What safety statements are associated with Glyoxalbis(2-hydroxyanil?

The safety statements are 26-36